C15H11Br2Cl2NO — CID 114370055
2,5-dibromo-N-[1-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 114370055) has the molecular formula C15H11Br2Cl2NO and a molecular weight of 451.97 g/mol. Its IUPAC name is 2,5-dibromo-N-[1-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 2,5-dibromo-N-[1-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 114370055 |
| Molecular Formula | C15H11Br2Cl2NO |
| Molecular Weight | 451.97 g/mol |
| Exact Mass | 448.86 |
| IUPAC Name | 2,5-dibromo-N-[1-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cc(Br)ccc1Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Br2Cl2NO/c1-8(11-4-3-10(18)7-14(11)19)20-15(21)12-6-9(16)2-5-13(12)17/h2-8H,1H3,(H,20,21) |
| InChIKey | VTLGNJJDJOZWKV-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.97 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |