C15H15Cl2NO2 — CID 4876390
N-[1-(2,4-dichlorophenyl)ethyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 4876390) has the molecular formula C15H15Cl2NO2 and a molecular weight of 312.20 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 4876390 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)c2ccc(Cl)cc2Cl)c(C)o1 |
| InChI | InChI=1S/C15H15Cl2NO2/c1-8-6-13(10(3)20-8)15(19)18-9(2)12-5-4-11(16)7-14(12)17/h4-7,9H,1-3H3,(H,18,19) |
| InChIKey | NRZHRTCFWBYXFR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |