5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid

C15H12BrCl2NO2 — CID 114895419

IUPAC5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid
SMILESCC(Nc1ccc(Br)cc1C(=O)O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C15H12BrCl2NO2/c1-8(11-4-3-10(17)7-13(11)18)19-14-5-2-9(16)6-12(14)15(20)21/h2-8,19H,1H3,(H,20,21)
InChIKeyMSOGIFYLJVXQTF-UHFFFAOYSA-N
MW389.08 g/mol
LogP5.63
Rot. Bonds4

About 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid

5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid (PubChem CID 114895419) has the molecular formula C15H12BrCl2NO2 and a molecular weight of 389.08 g/mol. Its IUPAC name is 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid.

Molecular Properties

Compound Name5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid
PubChem CID114895419
Molecular FormulaC15H12BrCl2NO2
Molecular Weight389.08 g/mol
Exact Mass386.94
IUPAC Name5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid
SMILESCC(Nc1ccc(Br)cc1C(=O)O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C15H12BrCl2NO2/c1-8(11-4-3-10(17)7-13(11)18)19-14-5-2-9(16)6-12(14)15(20)21/h2-8,19H,1H3,(H,20,21)
InChIKeyMSOGIFYLJVXQTF-UHFFFAOYSA-N
XLogP5.63
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500389.08
LogP ≤ 55.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid?
The IUPAC name of 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid (CID 114895419) is 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid.
What is the SMILES notation for 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid?
The canonical SMILES for 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid is CC(Nc1ccc(Br)cc1C(=O)O)c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid?
The InChIKey is MSOGIFYLJVXQTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrCl2NO2/c1-8(11-4-3-10(17)7-13(11)18)19-14-5-2-9(16)6-12(14)15(20)21/h2-8,19H,1H3,(H,20,21).
What are the key properties of 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid?
5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid has a molecular weight of 389.08 g/mol, XLogP of 5.63, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[1-(2,4-dichlorophenyl)ethylamino]benzoic acid is sourced from PubChem (CID 114895419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).