3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid

C15H12Cl2N2O4 — CID 18467620

IUPAC3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid
SMILESCC(Nc1cccc(C(=O)O)c1[N+](=O)[O-])c1ccc(Cl)cc1Cl
InChIInChI=1S/C15H12Cl2N2O4/c1-8(10-6-5-9(16)7-12(10)17)18-13-4-2-3-11(15(20)21)14(13)19(22)23/h2-8,18H,1H3,(H,20,21)
InChIKeyJEOVSBXBSCUAAW-UHFFFAOYSA-N
MW355.18 g/mol
LogP4.77
Rot. Bonds5

About 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid

3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid (PubChem CID 18467620) has the molecular formula C15H12Cl2N2O4 and a molecular weight of 355.18 g/mol. Its IUPAC name is 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid.

Molecular Properties

Compound Name3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid
PubChem CID18467620
Molecular FormulaC15H12Cl2N2O4
Molecular Weight355.18 g/mol
Exact Mass354.02
IUPAC Name3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid
SMILESCC(Nc1cccc(C(=O)O)c1[N+](=O)[O-])c1ccc(Cl)cc1Cl
InChIInChI=1S/C15H12Cl2N2O4/c1-8(10-6-5-9(16)7-12(10)17)18-13-4-2-3-11(15(20)21)14(13)19(22)23/h2-8,18H,1H3,(H,20,21)
InChIKeyJEOVSBXBSCUAAW-UHFFFAOYSA-N
XLogP4.77
TPSA92.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.18
LogP ≤ 54.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid?
The IUPAC name of 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid (CID 18467620) is 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid.
What is the SMILES notation for 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid?
The canonical SMILES for 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid is CC(Nc1cccc(C(=O)O)c1[N+](=O)[O-])c1ccc(Cl)cc1Cl.
What is the InChIKey of 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid?
The InChIKey is JEOVSBXBSCUAAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2N2O4/c1-8(10-6-5-9(16)7-12(10)17)18-13-4-2-3-11(15(20)21)14(13)19(22)23/h2-8,18H,1H3,(H,20,21).
What are the key properties of 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid?
3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid has a molecular weight of 355.18 g/mol, XLogP of 4.77, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,4-dichlorophenyl)ethylamino]-2-nitrobenzoic acid is sourced from PubChem (CID 18467620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).