C16H25N3O4S — CID 41198961
5-(dimethylsulfamoyl)-2-methyl-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide (PubChem CID 41198961) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-2-methyl-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide.
| Compound Name | 5-(dimethylsulfamoyl)-2-methyl-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 41198961 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 5-(dimethylsulfamoyl)-2-methyl-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide |
| SMILES | CCCNC(=O)[C@H](C)NC(=O)c1cc(S(=O)(=O)N(C)C)ccc1C |
| InChI | InChI=1S/C16H25N3O4S/c1-6-9-17-15(20)12(3)18-16(21)14-10-13(8-7-11(14)2)24(22,23)19(4)5/h7-8,10,12H,6,9H2,1-5H3,(H,17,20)(H,18,21)/t12-/m0/s1 |
| InChIKey | PQTIBZSXXOVVSC-LBPRGKRZSA-N |
| XLogP | 0.89 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |