C18H19Cl2N3O4S2 — CID 22108686
3-[[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]carbamoyl]-N,N,4-trimethylbenzenesulfonamide (PubChem CID 22108686) has the molecular formula C18H19Cl2N3O4S2 and a molecular weight of 476.41 g/mol. Its IUPAC name is 3-[[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]carbamoyl]-N,N,4-trimethylbenzenesulfonamide.
| Compound Name | 3-[[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]carbamoyl]-N,N,4-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22108686 |
| Molecular Formula | C18H19Cl2N3O4S2 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 3-[[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]carbamoyl]-N,N,4-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1C(=O)NNC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O4S2/c1-11-4-6-13(29(26,27)23(2)3)9-14(11)18(25)22-21-17(24)10-28-16-8-12(19)5-7-15(16)20/h4-9H,10H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | HUVHCVYUCRAWGH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|