C20H25ClN2O3S — CID 8920403
N-(3-chloro-2,6-diethylphenyl)-5-(dimethylsulfamoyl)-2-methylbenzamide (PubChem CID 8920403) has the molecular formula C20H25ClN2O3S and a molecular weight of 408.95 g/mol. Its IUPAC name is N-(3-chloro-2,6-diethylphenyl)-5-(dimethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-(3-chloro-2,6-diethylphenyl)-5-(dimethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 8920403 |
| Molecular Formula | C20H25ClN2O3S |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-(3-chloro-2,6-diethylphenyl)-5-(dimethylsulfamoyl)-2-methylbenzamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)c1cc(S(=O)(=O)N(C)C)ccc1C |
| InChI | InChI=1S/C20H25ClN2O3S/c1-6-14-9-11-18(21)16(7-2)19(14)22-20(24)17-12-15(10-8-13(17)3)27(25,26)23(4)5/h8-12H,6-7H2,1-5H3,(H,22,24) |
| InChIKey | HNXVVUSIKZWZKH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |