C17H16Cl2INO — CID 38908667
5-chloro-N-(3-chloro-2,6-diethylphenyl)-2-iodobenzamide (PubChem CID 38908667) has the molecular formula C17H16Cl2INO and a molecular weight of 448.13 g/mol. Its IUPAC name is 5-chloro-N-(3-chloro-2,6-diethylphenyl)-2-iodobenzamide.
| Compound Name | 5-chloro-N-(3-chloro-2,6-diethylphenyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 38908667 |
| Molecular Formula | C17H16Cl2INO |
| Molecular Weight | 448.13 g/mol |
| Exact Mass | 446.97 |
| IUPAC Name | 5-chloro-N-(3-chloro-2,6-diethylphenyl)-2-iodobenzamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C17H16Cl2INO/c1-3-10-5-7-14(19)12(4-2)16(10)21-17(22)13-9-11(18)6-8-15(13)20/h5-9H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | HZEVIMUIQKVDRU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.13 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|