C21H24Cl2N2O2 — CID 26198654
4-chloro-N-[4-(3-chloro-2,6-diethylanilino)-4-oxobutyl]benzamide (PubChem CID 26198654) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 4-chloro-N-[4-(3-chloro-2,6-diethylanilino)-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-(3-chloro-2,6-diethylanilino)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 26198654 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 4-chloro-N-[4-(3-chloro-2,6-diethylanilino)-4-oxobutyl]benzamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)CCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-3-14-9-12-18(23)17(4-2)20(14)25-19(26)6-5-13-24-21(27)15-7-10-16(22)11-8-15/h7-12H,3-6,13H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | PTDBGAMERKOBMD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|