About 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide
4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide (PubChem CID 24981133) has the molecular formula C21H22ClF2N3O3
and a molecular weight of 437.87 g/mol. Its IUPAC name is 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide |
| PubChem CID | 24981133 |
| Molecular Formula | C21H22ClF2N3O3 |
| Molecular Weight | 437.87 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(=O)CCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClF2N3O3/c1-2-27(13-18(28)26-20-16(23)5-3-6-17(20)24)19(29)7-4-12-25-21(30)14-8-10-15(22)11-9-14/h3,5-6,8-11H,2,4,7,12-13H2,1H3,(H,25,30)(H,26,28) |
| InChIKey | RFTDLLFPJSITSR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.87 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide?
The IUPAC name of 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide (CID 24981133) is 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide.
What is the SMILES notation for 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide?
The canonical SMILES for 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide is CCN(CC(=O)Nc1c(F)cccc1F)C(=O)CCCNC(=O)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide?
The InChIKey is RFTDLLFPJSITSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClF2N3O3/c1-2-27(13-18(28)26-20-16(23)5-3-6-17(20)24)19(29)7-4-12-25-21(30)14-8-10-15(22)11-9-14/h3,5-6,8-11H,2,4,7,12-13H2,1H3,(H,25,30)(H,26,28).
What are the key properties of 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide?
4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide has a molecular weight of 437.87 g/mol, XLogP of 3.62, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide is sourced from PubChem (CID 24981133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).