C21H22ClF2N3O3 — CID 24981133
4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide (PubChem CID 24981133) has the molecular formula C21H22ClF2N3O3 and a molecular weight of 437.87 g/mol. Its IUPAC name is 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 24981133 |
| Molecular Formula | C21H22ClF2N3O3 |
| Molecular Weight | 437.87 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 4-chloro-N-[4-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-4-oxobutyl]benzamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(=O)CCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClF2N3O3/c1-2-27(13-18(28)26-20-16(23)5-3-6-17(20)24)19(29)7-4-12-25-21(30)14-8-10-15(22)11-9-14/h3,5-6,8-11H,2,4,7,12-13H2,1H3,(H,25,30)(H,26,28) |
| InChIKey | RFTDLLFPJSITSR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.87 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|