C20H22F2N2O3 — CID 25161505
N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethyl-4-phenoxybutanamide (PubChem CID 25161505) has the molecular formula C20H22F2N2O3 and a molecular weight of 376.40 g/mol. Its IUPAC name is N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethyl-4-phenoxybutanamide.
| Compound Name | N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethyl-4-phenoxybutanamide |
|---|---|
| PubChem CID | 25161505 |
| Molecular Formula | C20H22F2N2O3 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethyl-4-phenoxybutanamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C20H22F2N2O3/c1-2-24(14-18(25)23-20-16(21)10-6-11-17(20)22)19(26)12-7-13-27-15-8-4-3-5-9-15/h3-6,8-11H,2,7,12-14H2,1H3,(H,23,25) |
| InChIKey | BBJRPPTUOYXDCX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|