C13H17F2N3O2 — CID 119266607
3-amino-N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethylpropanamide (PubChem CID 119266607) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 3-amino-N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethylpropanamide.
| Compound Name | 3-amino-N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 119266607 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-amino-N-[2-(2,6-difluoroanilino)-2-oxoethyl]-N-ethylpropanamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(=O)CCN |
| InChI | InChI=1S/C13H17F2N3O2/c1-2-18(12(20)6-7-16)8-11(19)17-13-9(14)4-3-5-10(13)15/h3-5H,2,6-8,16H2,1H3,(H,17,19) |
| InChIKey | NKNLIYMOHLSDQC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |