C20H20F2N4O5 — CID 24982594
N-[3-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-3-oxopropyl]-4-nitrobenzamide (PubChem CID 24982594) has the molecular formula C20H20F2N4O5 and a molecular weight of 434.40 g/mol. Its IUPAC name is N-[3-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-3-oxopropyl]-4-nitrobenzamide.
| Compound Name | N-[3-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-3-oxopropyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 24982594 |
| Molecular Formula | C20H20F2N4O5 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[3-[[2-(2,6-difluoroanilino)-2-oxoethyl]-ethylamino]-3-oxopropyl]-4-nitrobenzamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(=O)CCNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20F2N4O5/c1-2-25(12-17(27)24-19-15(21)4-3-5-16(19)22)18(28)10-11-23-20(29)13-6-8-14(9-7-13)26(30)31/h3-9H,2,10-12H2,1H3,(H,23,29)(H,24,27) |
| InChIKey | RNJBKOYUOFJZAB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|