C21H23F2N3O4 — CID 24981022
N-[2-(2,6-difluoroanilino)-2-oxoethyl]-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-ethylpropanamide (PubChem CID 24981022) has the molecular formula C21H23F2N3O4 and a molecular weight of 419.43 g/mol. Its IUPAC name is N-[2-(2,6-difluoroanilino)-2-oxoethyl]-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-ethylpropanamide.
| Compound Name | N-[2-(2,6-difluoroanilino)-2-oxoethyl]-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 24981022 |
| Molecular Formula | C21H23F2N3O4 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[2-(2,6-difluoroanilino)-2-oxoethyl]-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-ethylpropanamide |
| SMILES | CCN(CC(=O)Nc1c(F)cccc1F)C(=O)CCN1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C21H23F2N3O4/c1-2-25(12-17(27)24-19-15(22)8-5-9-16(19)23)18(28)10-11-26-20(29)13-6-3-4-7-14(13)21(26)30/h3-5,8-9,13-14H,2,6-7,10-12H2,1H3,(H,24,27) |
| InChIKey | QHVXVRKOPYWVRA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|