C21H24ClN3O4 — CID 18079331
N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-ethylacetamide (PubChem CID 18079331) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-ethylacetamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 18079331 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-ethylacetamide |
| SMILES | CCN(CC(=O)NCc1ccc(Cl)cc1)C(=O)CN1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C21H24ClN3O4/c1-2-24(12-18(26)23-11-14-7-9-15(22)10-8-14)19(27)13-25-20(28)16-5-3-4-6-17(16)21(25)29/h3-4,7-10,16-17H,2,5-6,11-13H2,1H3,(H,23,26) |
| InChIKey | PKXIBYGERFJWJJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|