C14H19ClN2O2 — CID 108946721
N-[(4-chlorophenyl)methyl]-N',N'-diethylpropanediamide (PubChem CID 108946721) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N',N'-diethylpropanediamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N',N'-diethylpropanediamide |
|---|---|
| PubChem CID | 108946721 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N',N'-diethylpropanediamide |
| SMILES | CCN(CC)C(=O)CC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O2/c1-3-17(4-2)14(19)9-13(18)16-10-11-5-7-12(15)8-6-11/h5-8H,3-4,9-10H2,1-2H3,(H,16,18) |
| InChIKey | XIRQOJLWVWDDPP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|