C16H25ClN3O2+ — CID 8692080
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-[2-(diethylamino)-2-oxoethyl]-methylazanium (PubChem CID 8692080) has the molecular formula C16H25ClN3O2+ and a molecular weight of 326.85 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-[2-(diethylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-[2-(diethylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8692080 |
| Molecular Formula | C16H25ClN3O2+ |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-[2-(diethylamino)-2-oxoethyl]-methylazanium |
| SMILES | CCN(CC)C(=O)C[NH+](C)CC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClN3O2/c1-4-20(5-2)16(22)12-19(3)11-15(21)18-10-13-6-8-14(17)9-7-13/h6-9H,4-5,10-12H2,1-3H3,(H,18,21)/p+1 |
| InChIKey | VIDFZXPIXHIJGN-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |