C26H31ClN4O3 — CID 53029957
5-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N,N-diethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 53029957) has the molecular formula C26H31ClN4O3 and a molecular weight of 483.01 g/mol. Its IUPAC name is 5-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N,N-diethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide.
| Compound Name | 5-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N,N-diethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 53029957 |
| Molecular Formula | C26H31ClN4O3 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 5-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N,N-diethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(c1)N(CC(=O)NCc1ccc(Cl)cc1)C(=O)C1CCCCN21 |
| InChI | InChI=1S/C26H31ClN4O3/c1-3-29(4-2)25(33)19-10-13-21-23(15-19)31(26(34)22-7-5-6-14-30(21)22)17-24(32)28-16-18-8-11-20(27)12-9-18/h8-13,15,22H,3-7,14,16-17H2,1-2H3,(H,28,32) |
| InChIKey | WHYLQSWMYFMICP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |