C25H36N4O3 — CID 92752128
(6aS)-5-[2-(cyclohexylamino)-2-oxoethyl]-N,N-diethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 92752128) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is (6aS)-5-[2-(cyclohexylamino)-2-oxoethyl]-N,N-diethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide.
| Compound Name | (6aS)-5-[2-(cyclohexylamino)-2-oxoethyl]-N,N-diethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 92752128 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | (6aS)-5-[2-(cyclohexylamino)-2-oxoethyl]-N,N-diethyl-6-oxo-7,8,9,10-tetrahydro-6aH-pyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2c(c1)N(CC(=O)NC1CCCCC1)C(=O)[C@@H]1CCCCN21 |
| InChI | InChI=1S/C25H36N4O3/c1-3-27(4-2)24(31)18-13-14-20-22(16-18)29(25(32)21-12-8-9-15-28(20)21)17-23(30)26-19-10-6-5-7-11-19/h13-14,16,19,21H,3-12,15,17H2,1-2H3,(H,26,30)/t21-/m0/s1 |
| InChIKey | MTNULHSNOKADPN-NRFANRHFSA-N |
| XLogP | 3.32 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |