C22H24Cl2FN3O3 — CID 60572761
N-[4-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]-4-oxobutyl]-4-fluorobenzamide (PubChem CID 60572761) has the molecular formula C22H24Cl2FN3O3 and a molecular weight of 468.36 g/mol. Its IUPAC name is N-[4-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]-4-oxobutyl]-4-fluorobenzamide.
| Compound Name | N-[4-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]-4-oxobutyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 60572761 |
| Molecular Formula | C22H24Cl2FN3O3 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-[4-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]-4-oxobutyl]-4-fluorobenzamide |
| SMILES | CCCN(CC(=O)Nc1ccc(Cl)cc1Cl)C(=O)CCCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24Cl2FN3O3/c1-2-12-28(14-20(29)27-19-10-7-16(23)13-18(19)24)21(30)4-3-11-26-22(31)15-5-8-17(25)9-6-15/h5-10,13H,2-4,11-12,14H2,1H3,(H,26,31)(H,27,29) |
| InChIKey | SOIORLZHAXNOAC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|