C18H17ClF3NO — CID 7920564
N-(3-chloro-2,6-diethylphenyl)-4-(trifluoromethyl)benzamide (PubChem CID 7920564) has the molecular formula C18H17ClF3NO and a molecular weight of 355.79 g/mol. Its IUPAC name is N-(3-chloro-2,6-diethylphenyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(3-chloro-2,6-diethylphenyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 7920564 |
| Molecular Formula | C18H17ClF3NO |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-(3-chloro-2,6-diethylphenyl)-4-(trifluoromethyl)benzamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17ClF3NO/c1-3-11-7-10-15(19)14(4-2)16(11)23-17(24)12-5-8-13(9-6-12)18(20,21)22/h5-10H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | NTPQVGQJXBWXFH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |