C17H12F3IN2O2 — CID 129201787
N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide (PubChem CID 129201787) has the molecular formula C17H12F3IN2O2 and a molecular weight of 460.19 g/mol. Its IUPAC name is N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 129201787 |
| Molecular Formula | C17H12F3IN2O2 |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide |
| SMILES | CCc1nc2c(NC(=O)c3ccc(C(F)(F)F)cc3)c(I)ccc2o1 |
| InChI | InChI=1S/C17H12F3IN2O2/c1-2-13-22-15-12(25-13)8-7-11(21)14(15)23-16(24)9-3-5-10(6-4-9)17(18,19)20/h3-8H,2H2,1H3,(H,23,24) |
| InChIKey | LBTASUKGFGZTLA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|