About N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide
N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide (PubChem CID 129201787) has the molecular formula C17H12F3IN2O2
and a molecular weight of 460.19 g/mol. Its IUPAC name is N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide |
| PubChem CID | 129201787 |
| Molecular Formula | C17H12F3IN2O2 |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide |
| SMILES | CCc1nc2c(NC(=O)c3ccc(C(F)(F)F)cc3)c(I)ccc2o1 |
| InChI | InChI=1S/C17H12F3IN2O2/c1-2-13-22-15-12(25-13)8-7-11(21)14(15)23-16(24)9-3-5-10(6-4-9)17(18,19)20/h3-8H,2H2,1H3,(H,23,24) |
| InChIKey | LBTASUKGFGZTLA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide?
The IUPAC name of N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide (CID 129201787) is N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide.
What is the SMILES notation for N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide?
The canonical SMILES for N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide is CCc1nc2c(NC(=O)c3ccc(C(F)(F)F)cc3)c(I)ccc2o1.
What is the InChIKey of N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide?
The InChIKey is LBTASUKGFGZTLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3IN2O2/c1-2-13-22-15-12(25-13)8-7-11(21)14(15)23-16(24)9-3-5-10(6-4-9)17(18,19)20/h3-8H,2H2,1H3,(H,23,24).
What are the key properties of N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide?
N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide has a molecular weight of 460.19 g/mol, XLogP of 5.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethyl-5-iodo-1,3-benzoxazol-4-yl)-4-(trifluoromethyl)benzamide is sourced from PubChem (CID 129201787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).