C15H16ClNO4S — CID 94602272
2-(4-chlorophenyl)sulfonyl-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]acetamide (PubChem CID 94602272) has the molecular formula C15H16ClNO4S and a molecular weight of 341.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 94602272 |
| Molecular Formula | C15H16ClNO4S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[(1R)-1-(5-methylfuran-2-yl)ethyl]acetamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)CS(=O)(=O)c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C15H16ClNO4S/c1-10-3-8-14(21-10)11(2)17-15(18)9-22(19,20)13-6-4-12(16)5-7-13/h3-8,11H,9H2,1-2H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | XWICFJNKXOXGDM-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |