C18H20ClNO4S — CID 51276088
2-(4-chlorophenyl)sulfonyl-N-[1-(2-methoxy-5-methylphenyl)ethyl]acetamide (PubChem CID 51276088) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-[1-(2-methoxy-5-methylphenyl)ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-[1-(2-methoxy-5-methylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 51276088 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-[1-(2-methoxy-5-methylphenyl)ethyl]acetamide |
| SMILES | COc1ccc(C)cc1C(C)NC(=O)CS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-12-4-9-17(24-3)16(10-12)13(2)20-18(21)11-25(22,23)15-7-5-14(19)6-8-15/h4-10,13H,11H2,1-3H3,(H,20,21) |
| InChIKey | ICMFOEODPSOXMW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |