C16H14Cl2FNO3S — CID 86992770
N-[1-(2,4-dichlorophenyl)ethyl]-2-(4-fluorophenyl)sulfonylacetamide (PubChem CID 86992770) has the molecular formula C16H14Cl2FNO3S and a molecular weight of 390.26 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-2-(4-fluorophenyl)sulfonylacetamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-(4-fluorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 86992770 |
| Molecular Formula | C16H14Cl2FNO3S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-(4-fluorophenyl)sulfonylacetamide |
| SMILES | CC(NC(=O)CS(=O)(=O)c1ccc(F)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2FNO3S/c1-10(14-7-2-11(17)8-15(14)18)20-16(21)9-24(22,23)13-5-3-12(19)4-6-13/h2-8,10H,9H2,1H3,(H,20,21) |
| InChIKey | YWVKYHVBJVOYKT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |