C18H15Br3Cl2O3 — CID 23315409
methyl 2-(2,4-dichlorophenyl)-5-(2,4,6-tribromophenoxy)pentanoate (PubChem CID 23315409) has the molecular formula C18H15Br3Cl2O3 and a molecular weight of 589.93 g/mol. Its IUPAC name is methyl 2-(2,4-dichlorophenyl)-5-(2,4,6-tribromophenoxy)pentanoate.
| Compound Name | methyl 2-(2,4-dichlorophenyl)-5-(2,4,6-tribromophenoxy)pentanoate |
|---|---|
| PubChem CID | 23315409 |
| Molecular Formula | C18H15Br3Cl2O3 |
| Molecular Weight | 589.93 g/mol |
| Exact Mass | 585.79 |
| IUPAC Name | methyl 2-(2,4-dichlorophenyl)-5-(2,4,6-tribromophenoxy)pentanoate |
| SMILES | COC(=O)C(CCCOc1c(Br)cc(Br)cc1Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Br3Cl2O3/c1-25-18(24)13(12-5-4-11(22)9-16(12)23)3-2-6-26-17-14(20)7-10(19)8-15(17)21/h4-5,7-9,13H,2-3,6H2,1H3 |
| InChIKey | CDQGAKHIAZYDAC-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.93 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|