C21H18ClNO3 — CID 74086910
4-[3-[2-(6-chloroquinolin-2-yl)ethenyl]phenoxy]butanoic acid (PubChem CID 74086910) has the molecular formula C21H18ClNO3 and a molecular weight of 367.83 g/mol. Its IUPAC name is 4-[3-[2-(6-chloroquinolin-2-yl)ethenyl]phenoxy]butanoic acid.
| Compound Name | 4-[3-[2-(6-chloroquinolin-2-yl)ethenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 74086910 |
| Molecular Formula | C21H18ClNO3 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 4-[3-[2-(6-chloroquinolin-2-yl)ethenyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(C=Cc2ccc3cc(Cl)ccc3n2)c1 |
| InChI | InChI=1S/C21H18ClNO3/c22-17-8-11-20-16(14-17)7-10-18(23-20)9-6-15-3-1-4-19(13-15)26-12-2-5-21(24)25/h1,3-4,6-11,13-14H,2,5,12H2,(H,24,25) |
| InChIKey | LAURNBCWALNAEO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|