C21H18BrNO3S — CID 70359430
4-[3-[(E)-2-(7-bromoquinolin-2-yl)ethenyl]sulfanylphenoxy]butanoic acid (PubChem CID 70359430) has the molecular formula C21H18BrNO3S and a molecular weight of 444.35 g/mol. Its IUPAC name is 4-[3-[(E)-2-(7-bromoquinolin-2-yl)ethenyl]sulfanylphenoxy]butanoic acid.
| Compound Name | 4-[3-[(E)-2-(7-bromoquinolin-2-yl)ethenyl]sulfanylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 70359430 |
| Molecular Formula | C21H18BrNO3S |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 4-[3-[(E)-2-(7-bromoquinolin-2-yl)ethenyl]sulfanylphenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(S/C=C/c2ccc3ccc(Br)cc3n2)c1 |
| InChI | InChI=1S/C21H18BrNO3S/c22-16-8-6-15-7-9-17(23-20(15)13-16)10-12-27-19-4-1-3-18(14-19)26-11-2-5-21(24)25/h1,3-4,6-10,12-14H,2,5,11H2,(H,24,25)/b12-10+ |
| InChIKey | DKRKKKNEDUSCNU-ZRDIBKRKSA-N |
| XLogP | 6.00 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|