C21H16Cl2NNaO3 — CID 23689564
sodium 4-[3-[(E)-2-(6,7-dichloroquinolin-2-yl)ethenyl]phenoxy]butanoate (PubChem CID 23689564) has the molecular formula C21H16Cl2NNaO3 and a molecular weight of 424.26 g/mol. Its IUPAC name is sodium 4-[3-[(E)-2-(6,7-dichloroquinolin-2-yl)ethenyl]phenoxy]butanoate.
| Compound Name | sodium 4-[3-[(E)-2-(6,7-dichloroquinolin-2-yl)ethenyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 23689564 |
| Molecular Formula | C21H16Cl2NNaO3 |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | sodium 4-[3-[(E)-2-(6,7-dichloroquinolin-2-yl)ethenyl]phenoxy]butanoate |
| SMILES | O=C([O-])CCCOc1cccc(/C=C/c2ccc3cc(Cl)c(Cl)cc3n2)c1.[Na+] |
| InChI | InChI=1S/C21H17Cl2NO3.Na/c22-18-12-15-7-9-16(24-20(15)13-19(18)23)8-6-14-3-1-4-17(11-14)27-10-2-5-21(25)26;/h1,3-4,6-9,11-13H,2,5,10H2,(H,25,26);/q;+1/p-1/b8-6+; |
| InChIKey | HRXVCASFTGGYKC-WVLIHFOGSA-M |
| XLogP | 1.62 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|