C21H19NO3 — CID 10019718
4-[3-[(E)-2-quinolin-2-ylethenyl]phenoxy]butanoic acid (PubChem CID 10019718) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-[3-[(E)-2-quinolin-2-ylethenyl]phenoxy]butanoic acid.
| Compound Name | 4-[3-[(E)-2-quinolin-2-ylethenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 10019718 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-[3-[(E)-2-quinolin-2-ylethenyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(/C=C/c2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C21H19NO3/c23-21(24)9-4-14-25-19-7-3-5-16(15-19)10-12-18-13-11-17-6-1-2-8-20(17)22-18/h1-3,5-8,10-13,15H,4,9,14H2,(H,23,24)/b12-10+ |
| InChIKey | SQQYQKRQLZICSQ-ZRDIBKRKSA-N |
| XLogP | 4.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|