C21H18N2NaO3 — CID 67894241
CID 67894241 (PubChem CID 67894241) has the molecular formula C21H18N2NaO3 and a molecular weight of 369.38 g/mol.
| Compound Name | CID 67894241 |
|---|---|
| PubChem CID | 67894241 |
| Molecular Formula | C21H18N2NaO3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | — |
| SMILES | O=C(O)CCC(=O)Nc1cccc(C=Cc2ccc3ccccc3n2)c1.[Na] |
| InChI | InChI=1S/C21H18N2O3.Na/c24-20(12-13-21(25)26)23-18-6-3-4-15(14-18)8-10-17-11-9-16-5-1-2-7-19(16)22-17;/h1-11,14H,12-13H2,(H,23,24)(H,25,26); |
| InChIKey | FNTRFMFIRSGBFB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |