C26H26ClNO4S2 — CID 57131792
4-[3-carboxypropylsulfanyl-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]sulfanylbutanoic acid (PubChem CID 57131792) has the molecular formula C26H26ClNO4S2 and a molecular weight of 516.08 g/mol. Its IUPAC name is 4-[3-carboxypropylsulfanyl-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]sulfanylbutanoic acid.
| Compound Name | 4-[3-carboxypropylsulfanyl-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 57131792 |
| Molecular Formula | C26H26ClNO4S2 |
| Molecular Weight | 516.08 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 4-[3-carboxypropylsulfanyl-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]sulfanylbutanoic acid |
| SMILES | O=C(O)CCCSC(SCCCC(=O)O)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C26H26ClNO4S2/c27-21-11-9-19-10-13-22(28-23(19)17-21)12-8-18-4-1-5-20(16-18)26(33-14-2-6-24(29)30)34-15-3-7-25(31)32/h1,4-5,8-13,16-17,26H,2-3,6-7,14-15H2,(H,29,30)(H,31,32) |
| InChIKey | KOVZSJKAYUTPHH-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.08 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|