C25H26ClNNa2O4S2 — CID 86748754
CID 86748754 (PubChem CID 86748754) has the molecular formula C25H26ClNNa2O4S2 and a molecular weight of 550.05 g/mol.
| Compound Name | CID 86748754 |
|---|---|
| PubChem CID | 86748754 |
| Molecular Formula | C25H26ClNNa2O4S2 |
| Molecular Weight | 550.05 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | — |
| SMILES | O=C(O)CCSC(SCCC(=O)O)c1cccc(CCCc2ccc3ccc(Cl)cc3n2)c1.[Na].[Na] |
| InChI | InChI=1S/C25H26ClNO4S2.2Na/c26-20-9-7-18-8-10-21(27-22(18)16-20)6-2-4-17-3-1-5-19(15-17)25(32-13-11-23(28)29)33-14-12-24(30)31;;/h1,3,5,7-10,15-16,25H,2,4,6,11-14H2,(H,28,29)(H,30,31);; |
| InChIKey | BTEROGJDJZJDHW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.05 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|