C28H25ClNO3S- — CID 91934677
3-[1-[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]-3-phenylpropyl]sulfanylpropanoate (PubChem CID 91934677) has the molecular formula C28H25ClNO3S- and a molecular weight of 491.03 g/mol. Its IUPAC name is 3-[1-[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]-3-phenylpropyl]sulfanylpropanoate.
| Compound Name | 3-[1-[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]-3-phenylpropyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 91934677 |
| Molecular Formula | C28H25ClNO3S- |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 3-[1-[3-[(7-chloroquinolin-2-yl)methoxy]phenyl]-3-phenylpropyl]sulfanylpropanoate |
| SMILES | O=C([O-])CCSC(CCc1ccccc1)c1cccc(OCc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C28H26ClNO3S/c29-23-12-10-21-11-13-24(30-26(21)18-23)19-33-25-8-4-7-22(17-25)27(34-16-15-28(31)32)14-9-20-5-2-1-3-6-20/h1-8,10-13,17-18,27H,9,14-16,19H2,(H,31,32)/p-1 |
| InChIKey | HGPNOCWAHWOYFE-UHFFFAOYSA-M |
| XLogP | 6.01 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |