C27H28ClNO3S2 — CID 134906157
3-[(R)-[3-[(E)-2-(7-chloronaphthalen-2-yl)ethenyl]phenyl]-[3-(dimethylamino)-3-oxopropyl]sulfanylmethyl]sulfanylpropanoic acid (PubChem CID 134906157) has the molecular formula C27H28ClNO3S2 and a molecular weight of 514.11 g/mol. Its IUPAC name is 3-[(R)-[3-[(E)-2-(7-chloronaphthalen-2-yl)ethenyl]phenyl]-[3-(dimethylamino)-3-oxopropyl]sulfanylmethyl]sulfanylpropanoic acid.
| Compound Name | 3-[(R)-[3-[(E)-2-(7-chloronaphthalen-2-yl)ethenyl]phenyl]-[3-(dimethylamino)-3-oxopropyl]sulfanylmethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 134906157 |
| Molecular Formula | C27H28ClNO3S2 |
| Molecular Weight | 514.11 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 3-[(R)-[3-[(E)-2-(7-chloronaphthalen-2-yl)ethenyl]phenyl]-[3-(dimethylamino)-3-oxopropyl]sulfanylmethyl]sulfanylpropanoic acid |
| SMILES | CN(C)C(=O)CCS[C@H](SCCC(=O)O)c1cccc(/C=C/c2ccc3ccc(Cl)cc3c2)c1 |
| InChI | InChI=1S/C27H28ClNO3S2/c1-29(2)25(30)12-14-33-27(34-15-13-26(31)32)22-5-3-4-19(16-22)6-7-20-8-9-21-10-11-24(28)18-23(21)17-20/h3-11,16-18,27H,12-15H2,1-2H3,(H,31,32)/b7-6+/t27-/m1/s1 |
| InChIKey | UWADGYIIBFDUON-KFFOYYGSSA-N |
| XLogP | 7.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.11 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|