C26H26ClNO3S — CID 173322629
(2S)-3-[(1S)-1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-5-oxopentyl]sulfanyl-2-methylpropanoic acid (PubChem CID 173322629) has the molecular formula C26H26ClNO3S and a molecular weight of 468.02 g/mol. Its IUPAC name is (2S)-3-[(1S)-1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-5-oxopentyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | (2S)-3-[(1S)-1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-5-oxopentyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 173322629 |
| Molecular Formula | C26H26ClNO3S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | (2S)-3-[(1S)-1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-5-oxopentyl]sulfanyl-2-methylpropanoic acid |
| SMILES | C[C@H](CS[C@@H](CCCC=O)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1)C(=O)O |
| InChI | InChI=1S/C26H26ClNO3S/c1-18(26(30)31)17-32-25(7-2-3-14-29)21-6-4-5-19(15-21)8-12-23-13-10-20-9-11-22(27)16-24(20)28-23/h4-6,8-16,18,25H,2-3,7,17H2,1H3,(H,30,31)/t18-,25+/m1/s1 |
| InChIKey | PLDRKPNUWJTZLB-CJAUYULYSA-N |
| XLogP | 6.92 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|