C30H28Cl2N2O4S2 — CID 11685901
4-[3-[(4-chlorophenyl)sulfonylamino]-1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]sulfanylbutanoic acid (PubChem CID 11685901) has the molecular formula C30H28Cl2N2O4S2 and a molecular weight of 615.60 g/mol. Its IUPAC name is 4-[3-[(4-chlorophenyl)sulfonylamino]-1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]sulfanylbutanoic acid.
| Compound Name | 4-[3-[(4-chlorophenyl)sulfonylamino]-1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 11685901 |
| Molecular Formula | C30H28Cl2N2O4S2 |
| Molecular Weight | 615.60 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | 4-[3-[(4-chlorophenyl)sulfonylamino]-1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]sulfanylbutanoic acid |
| SMILES | O=C(O)CCCSC(CCNS(=O)(=O)c1ccc(Cl)cc1)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C30H28Cl2N2O4S2/c31-24-10-14-27(15-11-24)40(37,38)33-17-16-29(39-18-2-5-30(35)36)23-4-1-3-21(19-23)6-12-26-13-8-22-7-9-25(32)20-28(22)34-26/h1,3-4,6-15,19-20,29,33H,2,5,16-18H2,(H,35,36)/b12-6+ |
| InChIKey | DFKZLYFGBLTIKR-WUXMJOGZSA-N |
| XLogP | 7.72 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.60 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|