C35H39ClN2O2S — CID 67906809
2-[2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(4-hydroxy-4-methylpentyl)sulfanylpropyl]phenyl]propanamide (PubChem CID 67906809) has the molecular formula C35H39ClN2O2S and a molecular weight of 587.23 g/mol. Its IUPAC name is 2-[2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(4-hydroxy-4-methylpentyl)sulfanylpropyl]phenyl]propanamide.
| Compound Name | 2-[2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(4-hydroxy-4-methylpentyl)sulfanylpropyl]phenyl]propanamide |
|---|---|
| PubChem CID | 67906809 |
| Molecular Formula | C35H39ClN2O2S |
| Molecular Weight | 587.23 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | 2-[2-[3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-(4-hydroxy-4-methylpentyl)sulfanylpropyl]phenyl]propanamide |
| SMILES | CC(C(N)=O)c1ccccc1CCC(SCCCC(C)(C)O)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C35H39ClN2O2S/c1-24(34(37)39)31-11-5-4-9-26(31)15-19-33(41-21-7-20-35(2,3)40)28-10-6-8-25(22-28)12-17-30-18-14-27-13-16-29(36)23-32(27)38-30/h4-6,8-14,16-18,22-24,33,40H,7,15,19-21H2,1-3H3,(H2,37,39)/b17-12+ |
| InChIKey | PRQMORMMYNGGJI-SFQUDFHCSA-N |
| XLogP | 8.61 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.23 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|