C29H26ClNO2 — CID 87246458
3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(1-hydroxypropan-2-yl)phenyl]propanal (PubChem CID 87246458) has the molecular formula C29H26ClNO2 and a molecular weight of 455.99 g/mol. Its IUPAC name is 3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(1-hydroxypropan-2-yl)phenyl]propanal.
| Compound Name | 3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(1-hydroxypropan-2-yl)phenyl]propanal |
|---|---|
| PubChem CID | 87246458 |
| Molecular Formula | C29H26ClNO2 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[2-(1-hydroxypropan-2-yl)phenyl]propanal |
| SMILES | CC(CO)c1ccccc1C(CC=O)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C29H26ClNO2/c1-20(19-33)26-7-2-3-8-28(26)27(15-16-32)23-6-4-5-21(17-23)9-13-25-14-11-22-10-12-24(30)18-29(22)31-25/h2-14,16-18,20,27,33H,15,19H2,1H3 |
| InChIKey | XQIVZWSEUNZOAD-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|