C23H22ClNO4 — CID 142768452
2-[2-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2-ethoxyethoxy]acetic acid (PubChem CID 142768452) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is 2-[2-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2-ethoxyethoxy]acetic acid.
| Compound Name | 2-[2-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2-ethoxyethoxy]acetic acid |
|---|---|
| PubChem CID | 142768452 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-[2-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-2-ethoxyethoxy]acetic acid |
| SMILES | CCOC(COCC(=O)O)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C23H22ClNO4/c1-2-29-22(14-28-15-23(26)27)18-5-3-4-16(12-18)6-10-20-11-8-17-7-9-19(24)13-21(17)25-20/h3-13,22H,2,14-15H2,1H3,(H,26,27)/b10-6+ |
| InChIKey | UBKLUDPHJVRMLT-UXBLZVDNSA-N |
| XLogP | 5.24 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |