C28H24ClNO5S — CID 91175692
2-[(3S)-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-methylsulfonyloxypropyl]benzoic acid (PubChem CID 91175692) has the molecular formula C28H24ClNO5S and a molecular weight of 522.02 g/mol. Its IUPAC name is 2-[(3S)-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-methylsulfonyloxypropyl]benzoic acid.
| Compound Name | 2-[(3S)-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-methylsulfonyloxypropyl]benzoic acid |
|---|---|
| PubChem CID | 91175692 |
| Molecular Formula | C28H24ClNO5S |
| Molecular Weight | 522.02 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 2-[(3S)-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-methylsulfonyloxypropyl]benzoic acid |
| SMILES | CS(=O)(=O)O[C@@H](CCc1ccccc1C(=O)O)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C28H24ClNO5S/c1-36(33,34)35-27(16-12-20-6-2-3-8-25(20)28(31)32)22-7-4-5-19(17-22)9-14-24-15-11-21-10-13-23(29)18-26(21)30-24/h2-11,13-15,17-18,27H,12,16H2,1H3,(H,31,32)/t27-/m0/s1 |
| InChIKey | PIZOGAFKVQAJSA-MHZLTWQESA-N |
| XLogP | 6.41 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.02 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|