C36H42ClNO5SSi — CID 54164197
2-trimethylsilylethyl (2R)-2-[2-[(3R)-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-methylsulfonyloxypropyl]phenyl]butanoate (PubChem CID 54164197) has the molecular formula C36H42ClNO5SSi and a molecular weight of 664.34 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2R)-2-[2-[(3R)-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-methylsulfonyloxypropyl]phenyl]butanoate.
| Compound Name | 2-trimethylsilylethyl (2R)-2-[2-[(3R)-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-methylsulfonyloxypropyl]phenyl]butanoate |
|---|---|
| PubChem CID | 54164197 |
| Molecular Formula | C36H42ClNO5SSi |
| Molecular Weight | 664.34 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | 2-trimethylsilylethyl (2R)-2-[2-[(3R)-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-methylsulfonyloxypropyl]phenyl]butanoate |
| SMILES | CC[C@@H](C(=O)OCC[Si](C)(C)C)c1ccccc1CC[C@@H](OS(C)(=O)=O)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C36H42ClNO5SSi/c1-6-32(36(39)42-22-23-45(3,4)5)33-13-8-7-11-27(33)17-21-35(43-44(2,40)41)29-12-9-10-26(24-29)14-19-31-20-16-28-15-18-30(37)25-34(28)38-31/h7-16,18-20,24-25,32,35H,6,17,21-23H2,1-5H3/t32-,35-/m1/s1 |
| InChIKey | OQMWJIOJESYMGD-FHPVIJFVSA-N |
| XLogP | 9.08 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.34 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|