C30H30ClNO4S — CID 173070906
[(1S)-1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[3-(2-hydroxypropan-2-yl)phenyl]propyl] methanesulfonate (PubChem CID 173070906) has the molecular formula C30H30ClNO4S and a molecular weight of 536.09 g/mol. Its IUPAC name is [(1S)-1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[3-(2-hydroxypropan-2-yl)phenyl]propyl] methanesulfonate.
| Compound Name | [(1S)-1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[3-(2-hydroxypropan-2-yl)phenyl]propyl] methanesulfonate |
|---|---|
| PubChem CID | 173070906 |
| Molecular Formula | C30H30ClNO4S |
| Molecular Weight | 536.09 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | [(1S)-1-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-[3-(2-hydroxypropan-2-yl)phenyl]propyl] methanesulfonate |
| SMILES | CC(C)(O)c1cccc(CC[C@H](OS(C)(=O)=O)c2cccc(C=Cc3ccc4ccc(Cl)cc4n3)c2)c1 |
| InChI | InChI=1S/C30H30ClNO4S/c1-30(2,33)25-9-5-7-22(19-25)11-17-29(36-37(3,34)35)24-8-4-6-21(18-24)10-15-27-16-13-23-12-14-26(31)20-28(23)32-27/h4-10,12-16,18-20,29,33H,11,17H2,1-3H3/t29-/m0/s1 |
| InChIKey | QQJFJFAKNYPACH-LJAQVGFWSA-N |
| XLogP | 6.94 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.09 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|