C32H35NO4S — CID 143243302
[1-[3-[(E)-2-(7-ethylquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl] methanesulfonate (PubChem CID 143243302) has the molecular formula C32H35NO4S and a molecular weight of 529.70 g/mol. Its IUPAC name is [1-[3-[(E)-2-(7-ethylquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl] methanesulfonate.
| Compound Name | [1-[3-[(E)-2-(7-ethylquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl] methanesulfonate |
|---|---|
| PubChem CID | 143243302 |
| Molecular Formula | C32H35NO4S |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | [1-[3-[(E)-2-(7-ethylquinolin-2-yl)ethenyl]phenyl]-3-[2-(2-hydroxypropan-2-yl)phenyl]propyl] methanesulfonate |
| SMILES | CCc1ccc2ccc(/C=C/c3cccc(C(CCc4ccccc4C(C)(C)O)OS(C)(=O)=O)c3)nc2c1 |
| InChI | InChI=1S/C32H35NO4S/c1-5-23-13-15-26-16-19-28(33-30(26)22-23)18-14-24-9-8-11-27(21-24)31(37-38(4,35)36)20-17-25-10-6-7-12-29(25)32(2,3)34/h6-16,18-19,21-22,31,34H,5,17,20H2,1-4H3/b18-14+ |
| InChIKey | MHMCKFRZEQSITG-NBVRZTHBSA-N |
| XLogP | 6.85 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|