C34H36ClNO4Si — CID 54485791
2-[2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]phenyl]-2-oxoacetic acid (PubChem CID 54485791) has the molecular formula C34H36ClNO4Si and a molecular weight of 586.20 g/mol. Its IUPAC name is 2-[2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]phenyl]-2-oxoacetic acid.
| Compound Name | 2-[2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 54485791 |
| Molecular Formula | C34H36ClNO4Si |
| Molecular Weight | 586.20 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 2-[2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]phenyl]-2-oxoacetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CCc1ccccc1C(=O)C(=O)O)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C34H36ClNO4Si/c1-34(2,3)41(4,5)40-31(20-16-24-10-6-7-12-29(24)32(37)33(38)39)26-11-8-9-23(21-26)13-18-28-19-15-25-14-17-27(35)22-30(25)36-28/h6-15,17-19,21-22,31H,16,20H2,1-5H3,(H,38,39)/t31-/m0/s1 |
| InChIKey | XSFCCZCCDVWCFH-HKBQPEDESA-N |
| XLogP | 9.02 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.20 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|