C30H28ClN — CID 67017455
7-chloro-2-[2-[3-[(2S)-4-(2-prop-1-en-2-ylphenyl)butan-2-yl]phenyl]ethenyl]quinoline (PubChem CID 67017455) has the molecular formula C30H28ClN and a molecular weight of 438.01 g/mol. Its IUPAC name is 7-chloro-2-[2-[3-[(2S)-4-(2-prop-1-en-2-ylphenyl)butan-2-yl]phenyl]ethenyl]quinoline.
| Compound Name | 7-chloro-2-[2-[3-[(2S)-4-(2-prop-1-en-2-ylphenyl)butan-2-yl]phenyl]ethenyl]quinoline |
|---|---|
| PubChem CID | 67017455 |
| Molecular Formula | C30H28ClN |
| Molecular Weight | 438.01 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 7-chloro-2-[2-[3-[(2S)-4-(2-prop-1-en-2-ylphenyl)butan-2-yl]phenyl]ethenyl]quinoline |
| SMILES | C=C(C)c1ccccc1CC[C@H](C)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C30H28ClN/c1-21(2)29-10-5-4-8-24(29)13-11-22(3)26-9-6-7-23(19-26)12-17-28-18-15-25-14-16-27(31)20-30(25)32-28/h4-10,12,14-20,22H,1,11,13H2,2-3H3/t22-/m0/s1 |
| InChIKey | ZOIGLQYQCPHNSB-QFIPXVFZSA-N |
| XLogP | 8.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.01 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |