C30H28ClNO4 — CID 142768351
2-[2-butoxy-2-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]ethoxy]benzoic acid (PubChem CID 142768351) has the molecular formula C30H28ClNO4 and a molecular weight of 502.01 g/mol. Its IUPAC name is 2-[2-butoxy-2-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]ethoxy]benzoic acid.
| Compound Name | 2-[2-butoxy-2-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 142768351 |
| Molecular Formula | C30H28ClNO4 |
| Molecular Weight | 502.01 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 2-[2-butoxy-2-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]ethoxy]benzoic acid |
| SMILES | CCCCOC(COc1ccccc1C(=O)O)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C30H28ClNO4/c1-2-3-17-35-29(20-36-28-10-5-4-9-26(28)30(33)34)23-8-6-7-21(18-23)11-15-25-16-13-22-12-14-24(31)19-27(22)32-25/h4-16,18-19,29H,2-3,17,20H2,1H3,(H,33,34)/b15-11+ |
| InChIKey | JSCFHXKWLBZCIA-RVDMUPIBSA-N |
| XLogP | 7.69 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.01 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|