C28H24ClNO3 — CID 66691844
2-[3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]-3-methylbenzoic acid (PubChem CID 66691844) has the molecular formula C28H24ClNO3 and a molecular weight of 457.96 g/mol. Its IUPAC name is 2-[3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]-3-methylbenzoic acid.
| Compound Name | 2-[3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 66691844 |
| Molecular Formula | C28H24ClNO3 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 2-[3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-3-hydroxypropyl]-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1CCC(O)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C28H24ClNO3/c1-18-4-2-7-25(28(32)33)24(18)14-15-27(31)21-6-3-5-19(16-21)8-12-23-13-10-20-9-11-22(29)17-26(20)30-23/h2-13,16-17,27,31H,14-15H2,1H3,(H,32,33) |
| InChIKey | UAYXEHBRFHRQLU-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |