C28H24ClNO3 — CID 67270844
methyl 2-[3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-1-hydroxypropyl]benzoate (PubChem CID 67270844) has the molecular formula C28H24ClNO3 and a molecular weight of 457.96 g/mol. Its IUPAC name is methyl 2-[3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-1-hydroxypropyl]benzoate.
| Compound Name | methyl 2-[3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-1-hydroxypropyl]benzoate |
|---|---|
| PubChem CID | 67270844 |
| Molecular Formula | C28H24ClNO3 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | methyl 2-[3-[3-[2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-1-hydroxypropyl]benzoate |
| SMILES | COC(=O)c1ccccc1C(O)CCc1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C28H24ClNO3/c1-33-28(32)25-8-3-2-7-24(25)27(31)16-10-20-6-4-5-19(17-20)9-14-23-15-12-21-11-13-22(29)18-26(21)30-23/h2-9,11-15,17-18,27,31H,10,16H2,1H3 |
| InChIKey | OGDBALYPYIDVID-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |