C30H25BrClNO4 — CID 71312970
methyl 2-[(3R)-3-acetyloxy-1-bromo-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]benzoate (PubChem CID 71312970) has the molecular formula C30H25BrClNO4 and a molecular weight of 578.89 g/mol. Its IUPAC name is methyl 2-[(3R)-3-acetyloxy-1-bromo-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]benzoate.
| Compound Name | methyl 2-[(3R)-3-acetyloxy-1-bromo-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]benzoate |
|---|---|
| PubChem CID | 71312970 |
| Molecular Formula | C30H25BrClNO4 |
| Molecular Weight | 578.89 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | methyl 2-[(3R)-3-acetyloxy-1-bromo-3-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]benzoate |
| SMILES | COC(=O)c1ccccc1C(Br)C[C@@H](OC(C)=O)c1cccc(/C=C/c2ccc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C30H25BrClNO4/c1-19(34)37-29(18-27(31)25-8-3-4-9-26(25)30(35)36-2)22-7-5-6-20(16-22)10-14-24-15-12-21-11-13-23(32)17-28(21)33-24/h3-17,27,29H,18H2,1-2H3/b14-10+/t27?,29-/m1/s1 |
| InChIKey | HSBFIKUWWYDDPH-DNZJWFKUSA-N |
| XLogP | 7.98 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.89 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|